C42H70O6Si2 — CID 176819374
bis(3,5-dimethylhex-1-yn-3-yloxy)-methoxy-[tris(3,5-dimethylhex-1-yn-3-yloxy)silylmethyl]silane (PubChem CID 176819374) has the molecular formula C42H70O6Si2 and a molecular weight of 727.19 g/mol. Its IUPAC name is bis(3,5-dimethylhex-1-yn-3-yloxy)-methoxy-[tris(3,5-dimethylhex-1-yn-3-yloxy)silylmethyl]silane.
| Compound Name | bis(3,5-dimethylhex-1-yn-3-yloxy)-methoxy-[tris(3,5-dimethylhex-1-yn-3-yloxy)silylmethyl]silane |
|---|---|
| PubChem CID | 176819374 |
| Molecular Formula | C42H70O6Si2 |
| Molecular Weight | 727.19 g/mol |
| Exact Mass | 726.47 |
| IUPAC Name | bis(3,5-dimethylhex-1-yn-3-yloxy)-methoxy-[tris(3,5-dimethylhex-1-yn-3-yloxy)silylmethyl]silane |
| SMILES | C#CC(C)(CC(C)C)O[Si](C[Si](OC(C)(C#C)CC(C)C)(OC(C)(C#C)CC(C)C)OC(C)(C#C)CC(C)C)(OC)OC(C)(C#C)CC(C)C |
| InChI | InChI=1S/C42H70O6Si2/c1-22-38(16,27-33(6)7)44-49(43-21,45-39(17,23-2)28-34(8)9)32-50(46-40(18,24-3)29-35(10)11,47-41(19,25-4)30-36(12)13)48-42(20,26-5)31-37(14)15/h1-5,33-37H,27-32H2,6-21H3 |
| InChIKey | CAVPYYVHJSATLO-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.19 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|