C33H56O6Si2 — CID 176819367
[bis(3,5-dimethylhex-1-yn-3-yloxy)-hydroxysilyl]methyl-bis(3,5-dimethylhex-1-yn-3-yloxy)-hydroxysilane (PubChem CID 176819367) has the molecular formula C33H56O6Si2 and a molecular weight of 604.98 g/mol. Its IUPAC name is [bis(3,5-dimethylhex-1-yn-3-yloxy)-hydroxysilyl]methyl-bis(3,5-dimethylhex-1-yn-3-yloxy)-hydroxysilane.
| Compound Name | [bis(3,5-dimethylhex-1-yn-3-yloxy)-hydroxysilyl]methyl-bis(3,5-dimethylhex-1-yn-3-yloxy)-hydroxysilane |
|---|---|
| PubChem CID | 176819367 |
| Molecular Formula | C33H56O6Si2 |
| Molecular Weight | 604.98 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | [bis(3,5-dimethylhex-1-yn-3-yloxy)-hydroxysilyl]methyl-bis(3,5-dimethylhex-1-yn-3-yloxy)-hydroxysilane |
| SMILES | C#CC(C)(CC(C)C)O[Si](O)(C[Si](O)(OC(C)(C#C)CC(C)C)OC(C)(C#C)CC(C)C)OC(C)(C#C)CC(C)C |
| InChI | InChI=1S/C33H56O6Si2/c1-17-30(13,21-26(5)6)36-40(34,37-31(14,18-2)22-27(7)8)25-41(35,38-32(15,19-3)23-28(9)10)39-33(16,20-4)24-29(11)12/h1-4,26-29,34-35H,21-25H2,5-16H3 |
| InChIKey | AWEZSWYCHUUYQF-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.98 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|