C41H68O6Si2 — CID 176819364
bis(3,5-dimethylhex-1-yn-3-yloxy)-hydroxy-[tris(3,5-dimethylhex-1-yn-3-yloxy)silylmethyl]silane (PubChem CID 176819364) has the molecular formula C41H68O6Si2 and a molecular weight of 713.16 g/mol. Its IUPAC name is bis(3,5-dimethylhex-1-yn-3-yloxy)-hydroxy-[tris(3,5-dimethylhex-1-yn-3-yloxy)silylmethyl]silane.
| Compound Name | bis(3,5-dimethylhex-1-yn-3-yloxy)-hydroxy-[tris(3,5-dimethylhex-1-yn-3-yloxy)silylmethyl]silane |
|---|---|
| PubChem CID | 176819364 |
| Molecular Formula | C41H68O6Si2 |
| Molecular Weight | 713.16 g/mol |
| Exact Mass | 712.46 |
| IUPAC Name | bis(3,5-dimethylhex-1-yn-3-yloxy)-hydroxy-[tris(3,5-dimethylhex-1-yn-3-yloxy)silylmethyl]silane |
| SMILES | C#CC(C)(CC(C)C)O[Si](O)(C[Si](OC(C)(C#C)CC(C)C)(OC(C)(C#C)CC(C)C)OC(C)(C#C)CC(C)C)OC(C)(C#C)CC(C)C |
| InChI | InChI=1S/C41H68O6Si2/c1-21-37(16,26-32(6)7)43-48(42,44-38(17,22-2)27-33(8)9)31-49(45-39(18,23-3)28-34(10)11,46-40(19,24-4)29-35(12)13)47-41(20,25-5)30-36(14)15/h1-5,32-36,42H,26-31H2,6-20H3 |
| InChIKey | XKNIGFBKOHYMMG-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.16 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|