C16H14F3NOS — CID 100922140
1,1,1-trifluoro-3-(4-methylphenyl)sulfinyl-N-phenylpropan-2-imine (PubChem CID 100922140) has the molecular formula C16H14F3NOS and a molecular weight of 325.36 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(4-methylphenyl)sulfinyl-N-phenylpropan-2-imine.
| Compound Name | 1,1,1-trifluoro-3-(4-methylphenyl)sulfinyl-N-phenylpropan-2-imine |
|---|---|
| PubChem CID | 100922140 |
| Molecular Formula | C16H14F3NOS |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 1,1,1-trifluoro-3-(4-methylphenyl)sulfinyl-N-phenylpropan-2-imine |
| SMILES | Cc1ccc(S(=O)C/C(=N/c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F3NOS/c1-12-7-9-14(10-8-12)22(21)11-15(16(17,18)19)20-13-5-3-2-4-6-13/h2-10H,11H2,1H3/b20-15- |
| InChIKey | VMTBYXPKMOVLRE-HKWRFOASSA-N |
| XLogP | 4.44 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|