C20H14F2N2O3 — CID 100922534
12-cyclopropyl-9,11-difluoro-4-methoxy-5H-quinolino[4,3-b]quinoline-6,7-dione (PubChem CID 100922534) has the molecular formula C20H14F2N2O3 and a molecular weight of 368.34 g/mol. Its IUPAC name is 12-cyclopropyl-9,11-difluoro-4-methoxy-5H-quinolino[4,3-b]quinoline-6,7-dione.
| Compound Name | 12-cyclopropyl-9,11-difluoro-4-methoxy-5H-quinolino[4,3-b]quinoline-6,7-dione |
|---|---|
| PubChem CID | 100922534 |
| Molecular Formula | C20H14F2N2O3 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 12-cyclopropyl-9,11-difluoro-4-methoxy-5H-quinolino[4,3-b]quinoline-6,7-dione |
| SMILES | COc1cccc2c1[nH]c(=O)c1c(=O)c3cc(F)cc(F)c3n(C3CC3)c12 |
| InChI | InChI=1S/C20H14F2N2O3/c1-27-14-4-2-3-11-16(14)23-20(26)15-18(11)24(10-5-6-10)17-12(19(15)25)7-9(21)8-13(17)22/h2-4,7-8,10H,5-6H2,1H3,(H,23,26) |
| InChIKey | XMOGFNPRJAMEQJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|