C28H28N2S6 — CID 100923474
4-[(E)-2-[2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1,3-dithiol-4-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 100923474) has the molecular formula C28H28N2S6 and a molecular weight of 584.95 g/mol. Its IUPAC name is 4-[(E)-2-[2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1,3-dithiol-4-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1,3-dithiol-4-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 100923474 |
| Molecular Formula | C28H28N2S6 |
| Molecular Weight | 584.95 g/mol |
| Exact Mass | 584.06 |
| IUPAC Name | 4-[(E)-2-[2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1,3-dithiol-4-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/C2=C(/C=C/c3ccc(N(C)C)cc3)SC(=C3SC4=C(SCCS4)S3)S2)cc1 |
| InChI | InChI=1S/C28H28N2S6/c1-29(2)21-11-5-19(6-12-21)9-15-23-24(16-10-20-7-13-22(14-8-20)30(3)4)34-27(33-23)28-35-25-26(36-28)32-18-17-31-25/h5-16H,17-18H2,1-4H3/b15-9+,16-10+ |
| InChIKey | IFHHFMDUJOGCIO-KAVGSWPWSA-N |
| XLogP | 9.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.95 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|