C13H26O — CID 100923980
(3R,4S)-3-ethyl-3-methyldec-1-en-4-ol (PubChem CID 100923980) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is (3R,4S)-3-ethyl-3-methyldec-1-en-4-ol.
| Compound Name | (3R,4S)-3-ethyl-3-methyldec-1-en-4-ol |
|---|---|
| PubChem CID | 100923980 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | (3R,4S)-3-ethyl-3-methyldec-1-en-4-ol |
| SMILES | C=C[C@@](C)(CC)[C@@H](O)CCCCCC |
| InChI | InChI=1S/C13H26O/c1-5-8-9-10-11-12(14)13(4,6-2)7-3/h6,12,14H,2,5,7-11H2,1,3-4H3/t12-,13-/m0/s1 |
| InChIKey | ACXQKAAEIBCMAD-STQMWFEESA-N |
| XLogP | 3.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|