C17H34O — CID 10354987
(5R,6R)-5-ethenyl-5-propyldodecan-6-ol (PubChem CID 10354987) has the molecular formula C17H34O and a molecular weight of 254.46 g/mol. Its IUPAC name is (5R,6R)-5-ethenyl-5-propyldodecan-6-ol.
| Compound Name | (5R,6R)-5-ethenyl-5-propyldodecan-6-ol |
|---|---|
| PubChem CID | 10354987 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | (5R,6R)-5-ethenyl-5-propyldodecan-6-ol |
| SMILES | C=C[C@@](CCC)(CCCC)[C@H](O)CCCCCC |
| InChI | InChI=1S/C17H34O/c1-5-9-11-12-13-16(18)17(8-4,14-7-3)15-10-6-2/h8,16,18H,4-7,9-15H2,1-3H3/t16-,17-/m1/s1 |
| InChIKey | DIQMLCSEARCGSF-IAGOWNOFSA-N |
| XLogP | 5.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|