C27H56O3 — CID 91021869
10-heptylicosane-9,10,11-triol (PubChem CID 91021869) has the molecular formula C27H56O3 and a molecular weight of 428.74 g/mol. Its IUPAC name is 10-heptylicosane-9,10,11-triol.
| Compound Name | 10-heptylicosane-9,10,11-triol |
|---|---|
| PubChem CID | 91021869 |
| Molecular Formula | C27H56O3 |
| Molecular Weight | 428.74 g/mol |
| Exact Mass | 428.42 |
| IUPAC Name | 10-heptylicosane-9,10,11-triol |
| SMILES | CCCCCCCCCC(O)C(O)(CCCCCCC)C(O)CCCCCCCC |
| InChI | InChI=1S/C27H56O3/c1-4-7-10-13-15-17-20-23-26(29)27(30,24-21-18-12-9-6-3)25(28)22-19-16-14-11-8-5-2/h25-26,28-30H,4-24H2,1-3H3 |
| InChIKey | WKDQKNUBSQEKIR-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.74 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|