C15H30O4 — CID 87746173
3,4,5-trihydroxy-4-pentyldecan-2-one (PubChem CID 87746173) has the molecular formula C15H30O4 and a molecular weight of 274.40 g/mol. Its IUPAC name is 3,4,5-trihydroxy-4-pentyldecan-2-one.
| Compound Name | 3,4,5-trihydroxy-4-pentyldecan-2-one |
|---|---|
| PubChem CID | 87746173 |
| Molecular Formula | C15H30O4 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | 3,4,5-trihydroxy-4-pentyldecan-2-one |
| SMILES | CCCCCC(O)C(O)(CCCCC)C(O)C(C)=O |
| InChI | InChI=1S/C15H30O4/c1-4-6-8-10-13(17)15(19,11-9-7-5-2)14(18)12(3)16/h13-14,17-19H,4-11H2,1-3H3 |
| InChIKey | NWUMFQUQSLVTIW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|