C16H32O3 — CID 87840656
5-pentylundec-1-ene-4,5,6-triol (PubChem CID 87840656) has the molecular formula C16H32O3 and a molecular weight of 272.43 g/mol. Its IUPAC name is 5-pentylundec-1-ene-4,5,6-triol.
| Compound Name | 5-pentylundec-1-ene-4,5,6-triol |
|---|---|
| PubChem CID | 87840656 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | 5-pentylundec-1-ene-4,5,6-triol |
| SMILES | C=CCC(O)C(O)(CCCCC)C(O)CCCCC |
| InChI | InChI=1S/C16H32O3/c1-4-7-9-12-15(18)16(19,13-10-8-5-2)14(17)11-6-3/h6,14-15,17-19H,3-5,7-13H2,1-2H3 |
| InChIKey | MNZKKWIAZATGNB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|