About 5-butyl-5-ethenyl-N-ethyl-N-methyltetradecan-6-amine
5-butyl-5-ethenyl-N-ethyl-N-methyltetradecan-6-amine (PubChem CID 157119798) has the molecular formula C23H47N
and a molecular weight of 337.64 g/mol. Its IUPAC name is 5-butyl-5-ethenyl-N-ethyl-N-methyltetradecan-6-amine.
Molecular Properties
| Compound Name | 5-butyl-5-ethenyl-N-ethyl-N-methyltetradecan-6-amine |
| PubChem CID | 157119798 |
| Molecular Formula | C23H47N |
| Molecular Weight | 337.64 g/mol |
| Exact Mass | 337.37 |
| IUPAC Name | 5-butyl-5-ethenyl-N-ethyl-N-methyltetradecan-6-amine |
| SMILES | C=CC(CCCC)(CCCC)C(CCCCCCCC)N(C)CC |
| InChI | InChI=1S/C23H47N/c1-7-12-15-16-17-18-19-22(24(6)11-5)23(10-4,20-13-8-2)21-14-9-3/h10,22H,4,7-9,11-21H2,1-3,5-6H3 |
| InChIKey | AHVIQJJIOJOVPI-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.64 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-butyl-5-ethenyl-N-ethyl-N-methyltetradecan-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-5-ethenyl-N-ethyl-N-methyltetradecan-6-amine?
The IUPAC name of 5-butyl-5-ethenyl-N-ethyl-N-methyltetradecan-6-amine (CID 157119798) is 5-butyl-5-ethenyl-N-ethyl-N-methyltetradecan-6-amine.
What is the SMILES notation for 5-butyl-5-ethenyl-N-ethyl-N-methyltetradecan-6-amine?
The canonical SMILES for 5-butyl-5-ethenyl-N-ethyl-N-methyltetradecan-6-amine is C=CC(CCCC)(CCCC)C(CCCCCCCC)N(C)CC.
What is the InChIKey of 5-butyl-5-ethenyl-N-ethyl-N-methyltetradecan-6-amine?
The InChIKey is AHVIQJJIOJOVPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H47N/c1-7-12-15-16-17-18-19-22(24(6)11-5)23(10-4,20-13-8-2)21-14-9-3/h10,22H,4,7-9,11-21H2,1-3,5-6H3.
What are the key properties of 5-butyl-5-ethenyl-N-ethyl-N-methyltetradecan-6-amine?
5-butyl-5-ethenyl-N-ethyl-N-methyltetradecan-6-amine has a molecular weight of 337.64 g/mol, XLogP of 7.61, 17 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-5-ethenyl-N-ethyl-N-methyltetradecan-6-amine is sourced from PubChem (CID 157119798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).