C24H49N — CID 161301643
5-butyl-5-ethenyl-N,N-diethyltetradecan-6-amine (PubChem CID 161301643) has the molecular formula C24H49N and a molecular weight of 351.66 g/mol. Its IUPAC name is 5-butyl-5-ethenyl-N,N-diethyltetradecan-6-amine.
| Compound Name | 5-butyl-5-ethenyl-N,N-diethyltetradecan-6-amine |
|---|---|
| PubChem CID | 161301643 |
| Molecular Formula | C24H49N |
| Molecular Weight | 351.66 g/mol |
| Exact Mass | 351.39 |
| IUPAC Name | 5-butyl-5-ethenyl-N,N-diethyltetradecan-6-amine |
| SMILES | C=CC(CCCC)(CCCC)C(CCCCCCCC)N(CC)CC |
| InChI | InChI=1S/C24H49N/c1-7-13-16-17-18-19-20-23(25(11-5)12-6)24(10-4,21-14-8-2)22-15-9-3/h10,23H,4,7-9,11-22H2,1-3,5-6H3 |
| InChIKey | VHRVLMQHZHPJDU-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.66 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|