C31H55NO6 — CID 100924401
methyl (2S,5Z,14Z)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]icosa-5,14-dienoate (PubChem CID 100924401) has the molecular formula C31H55NO6 and a molecular weight of 537.78 g/mol. Its IUPAC name is methyl (2S,5Z,14Z)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]icosa-5,14-dienoate.
| Compound Name | methyl (2S,5Z,14Z)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]icosa-5,14-dienoate |
|---|---|
| PubChem CID | 100924401 |
| Molecular Formula | C31H55NO6 |
| Molecular Weight | 537.78 g/mol |
| Exact Mass | 537.40 |
| IUPAC Name | methyl (2S,5Z,14Z)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]icosa-5,14-dienoate |
| SMILES | CCCCC/C=C\CCCCCCC/C=C\CC[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H55NO6/c1-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26(27(33)36-8)32(28(34)37-30(2,3)4)29(35)38-31(5,6)7/h13-14,22-23,26H,9-12,15-21,24-25H2,1-8H3/b14-13-,23-22-/t26-/m0/s1 |
| InChIKey | JIFNPURKLCOLQX-AXDSPHOTSA-N |
| XLogP | 8.90 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.78 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|