C18H32N2O2 — CID 100925533
5-[2-[(5,5-dimethyl-4-oxohexan-2-ylidene)amino]ethylimino]-2,2-dimethylhexan-3-one (PubChem CID 100925533) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 5-[2-[(5,5-dimethyl-4-oxohexan-2-ylidene)amino]ethylimino]-2,2-dimethylhexan-3-one.
| Compound Name | 5-[2-[(5,5-dimethyl-4-oxohexan-2-ylidene)amino]ethylimino]-2,2-dimethylhexan-3-one |
|---|---|
| PubChem CID | 100925533 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 5-[2-[(5,5-dimethyl-4-oxohexan-2-ylidene)amino]ethylimino]-2,2-dimethylhexan-3-one |
| SMILES | C/C(CC(=O)C(C)(C)C)=N\CC/N=C(\C)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H32N2O2/c1-13(11-15(21)17(3,4)5)19-9-10-20-14(2)12-16(22)18(6,7)8/h9-12H2,1-8H3/b19-13+,20-14+ |
| InChIKey | UVBOCFWIQKGGMH-IWGRKNQJSA-N |
| XLogP | 3.92 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|