About N-tert-butylbenzeneamine oxide
N-tert-butylbenzeneamine oxide (PubChem CID 100926006) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is N-tert-butylbenzeneamine oxide.
Molecular Properties
| Compound Name | N-tert-butylbenzeneamine oxide |
| PubChem CID | 100926006 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-tert-butylbenzeneamine oxide |
| SMILES | CC(C)(C)[NH+]([O-])c1ccccc1 |
| InChI | InChI=1S/C10H15NO/c1-10(2,3)11(12)9-7-5-4-6-8-9/h4-8,11H,1-3H3 |
| InChIKey | RYMIYYOEEOYOSP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 27.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butylbenzeneamine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butylbenzeneamine oxide?
The IUPAC name of N-tert-butylbenzeneamine oxide (CID 100926006) is N-tert-butylbenzeneamine oxide.
What is the SMILES notation for N-tert-butylbenzeneamine oxide?
The canonical SMILES for N-tert-butylbenzeneamine oxide is CC(C)(C)[NH+]([O-])c1ccccc1.
What is the InChIKey of N-tert-butylbenzeneamine oxide?
The InChIKey is RYMIYYOEEOYOSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-10(2,3)11(12)9-7-5-4-6-8-9/h4-8,11H,1-3H3.
What are the key properties of N-tert-butylbenzeneamine oxide?
N-tert-butylbenzeneamine oxide has a molecular weight of 165.24 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butylbenzeneamine oxide is sourced from PubChem (CID 100926006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).