C20H34O3Si2 — CID 100926248
[(3aR,9aR)-6,7-dimethoxy-5-trimethylsilyl-1,3,3a,4,9,9a-hexahydrobenzo[f][2]benzofuran-8-yl]-trimethylsilane (PubChem CID 100926248) has the molecular formula C20H34O3Si2 and a molecular weight of 378.66 g/mol. Its IUPAC name is [(3aR,9aR)-6,7-dimethoxy-5-trimethylsilyl-1,3,3a,4,9,9a-hexahydrobenzo[f][2]benzofuran-8-yl]-trimethylsilane.
| Compound Name | [(3aR,9aR)-6,7-dimethoxy-5-trimethylsilyl-1,3,3a,4,9,9a-hexahydrobenzo[f][2]benzofuran-8-yl]-trimethylsilane |
|---|---|
| PubChem CID | 100926248 |
| Molecular Formula | C20H34O3Si2 |
| Molecular Weight | 378.66 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [(3aR,9aR)-6,7-dimethoxy-5-trimethylsilyl-1,3,3a,4,9,9a-hexahydrobenzo[f][2]benzofuran-8-yl]-trimethylsilane |
| SMILES | COc1c(OC)c([Si](C)(C)C)c2c(c1[Si](C)(C)C)C[C@H]1COC[C@@H]1C2 |
| InChI | InChI=1S/C20H34O3Si2/c1-21-17-18(22-2)20(25(6,7)8)16-10-14-12-23-11-13(14)9-15(16)19(17)24(3,4)5/h13-14H,9-12H2,1-8H3/t13-,14-/m0/s1 |
| InChIKey | YFPSWUAXRLTTFX-KBPBESRZSA-N |
| XLogP | 3.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.66 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|