C28H42O2S — CID 100927274
(5-methyl-2-propan-2-ylcyclohexyl) 3-ethenyl-3,7-dimethyl-2-phenylsulfanyloct-6-enoate (PubChem CID 100927274) has the molecular formula C28H42O2S and a molecular weight of 442.71 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 3-ethenyl-3,7-dimethyl-2-phenylsulfanyloct-6-enoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 3-ethenyl-3,7-dimethyl-2-phenylsulfanyloct-6-enoate |
|---|---|
| PubChem CID | 100927274 |
| Molecular Formula | C28H42O2S |
| Molecular Weight | 442.71 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 3-ethenyl-3,7-dimethyl-2-phenylsulfanyloct-6-enoate |
| SMILES | C=CC(C)(CCC=C(C)C)C(Sc1ccccc1)C(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C28H42O2S/c1-8-28(7,18-12-13-20(2)3)26(31-23-14-10-9-11-15-23)27(29)30-25-19-22(6)16-17-24(25)21(4)5/h8-11,13-15,21-22,24-26H,1,12,16-19H2,2-7H3 |
| InChIKey | OGYZKCROGZANOR-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.71 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|