C16H17N5O4S2 — CID 10092810
2-[4-methylsulfonyl-5-(1H-1,2,4-triazol-5-ylsulfanyl)-6,7,8,9-tetrahydropyrido[3,2-b]indolizin-6-yl]acetic acid (PubChem CID 10092810) has the molecular formula C16H17N5O4S2 and a molecular weight of 407.48 g/mol. Its IUPAC name is 2-[4-methylsulfonyl-5-(1H-1,2,4-triazol-5-ylsulfanyl)-6,7,8,9-tetrahydropyrido[3,2-b]indolizin-6-yl]acetic acid.
| Compound Name | 2-[4-methylsulfonyl-5-(1H-1,2,4-triazol-5-ylsulfanyl)-6,7,8,9-tetrahydropyrido[3,2-b]indolizin-6-yl]acetic acid |
|---|---|
| PubChem CID | 10092810 |
| Molecular Formula | C16H17N5O4S2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 2-[4-methylsulfonyl-5-(1H-1,2,4-triazol-5-ylsulfanyl)-6,7,8,9-tetrahydropyrido[3,2-b]indolizin-6-yl]acetic acid |
| SMILES | CS(=O)(=O)c1ccnc2c1c(Sc1ncn[nH]1)c1n2CCCC1CC(=O)O |
| InChI | InChI=1S/C16H17N5O4S2/c1-27(24,25)10-4-5-17-15-12(10)14(26-16-18-8-19-20-16)13-9(7-11(22)23)3-2-6-21(13)15/h4-5,8-9H,2-3,6-7H2,1H3,(H,22,23)(H,18,19,20) |
| InChIKey | DAHJMASSBKDCCG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |