C10H11FO3 — CID 100929142
(1S,4S,8S)-8-ethoxy-5-fluorobicyclo[2.2.2]oct-5-ene-2,3-dione (PubChem CID 100929142) has the molecular formula C10H11FO3 and a molecular weight of 198.19 g/mol. Its IUPAC name is (1S,4S,8S)-8-ethoxy-5-fluorobicyclo[2.2.2]oct-5-ene-2,3-dione.
| Compound Name | (1S,4S,8S)-8-ethoxy-5-fluorobicyclo[2.2.2]oct-5-ene-2,3-dione |
|---|---|
| PubChem CID | 100929142 |
| Molecular Formula | C10H11FO3 |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | (1S,4S,8S)-8-ethoxy-5-fluorobicyclo[2.2.2]oct-5-ene-2,3-dione |
| SMILES | CCO[C@H]1C[C@H]2C=C(F)[C@@H]1C(=O)C2=O |
| InChI | InChI=1S/C10H11FO3/c1-2-14-7-4-5-3-6(11)8(7)10(13)9(5)12/h3,5,7-8H,2,4H2,1H3/t5-,7+,8+/m1/s1 |
| InChIKey | ITKWFOMQOWUXDA-DTLFHODZSA-N |
| XLogP | 1.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|