C11H14O3 — CID 85365181
7-ethoxy-5-methylbicyclo[2.2.2]oct-5-ene-2,3-dione (PubChem CID 85365181) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 7-ethoxy-5-methylbicyclo[2.2.2]oct-5-ene-2,3-dione.
| Compound Name | 7-ethoxy-5-methylbicyclo[2.2.2]oct-5-ene-2,3-dione |
|---|---|
| PubChem CID | 85365181 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 7-ethoxy-5-methylbicyclo[2.2.2]oct-5-ene-2,3-dione |
| SMILES | CCOC1CC2C(=O)C(=O)C1C=C2C |
| InChI | InChI=1S/C11H14O3/c1-3-14-9-5-7-6(2)4-8(9)11(13)10(7)12/h4,7-9H,3,5H2,1-2H3 |
| InChIKey | WDOPQURQOHASLY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|