C18H32O2 — CID 59080606
(2S,3R,4R,5R)-5-ethyl-3-methoxy-4-methyl-2-[(E)-6-methylhept-2-en-2-yl]cyclohexan-1-one (PubChem CID 59080606) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (2S,3R,4R,5R)-5-ethyl-3-methoxy-4-methyl-2-[(E)-6-methylhept-2-en-2-yl]cyclohexan-1-one.
| Compound Name | (2S,3R,4R,5R)-5-ethyl-3-methoxy-4-methyl-2-[(E)-6-methylhept-2-en-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 59080606 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (2S,3R,4R,5R)-5-ethyl-3-methoxy-4-methyl-2-[(E)-6-methylhept-2-en-2-yl]cyclohexan-1-one |
| SMILES | CC[C@@H]1CC(=O)[C@@H](/C(C)=C/CCC(C)C)[C@H](OC)[C@@H]1C |
| InChI | InChI=1S/C18H32O2/c1-7-15-11-16(19)17(18(20-6)14(15)5)13(4)10-8-9-12(2)3/h10,12,14-15,17-18H,7-9,11H2,1-6H3/b13-10+/t14-,15-,17-,18-/m1/s1 |
| InChIKey | ZLHRBXKJMBMKGC-HTTNULRLSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|