C24H42O3 — CID 91048946
2-(3,8-diethyl-6-methyldec-5-en-3-yl)-5-methoxy-3,6-dimethylcyclohexane-1,4-dione (PubChem CID 91048946) has the molecular formula C24H42O3 and a molecular weight of 378.60 g/mol. Its IUPAC name is 2-(3,8-diethyl-6-methyldec-5-en-3-yl)-5-methoxy-3,6-dimethylcyclohexane-1,4-dione.
| Compound Name | 2-(3,8-diethyl-6-methyldec-5-en-3-yl)-5-methoxy-3,6-dimethylcyclohexane-1,4-dione |
|---|---|
| PubChem CID | 91048946 |
| Molecular Formula | C24H42O3 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 2-(3,8-diethyl-6-methyldec-5-en-3-yl)-5-methoxy-3,6-dimethylcyclohexane-1,4-dione |
| SMILES | CCC(CC)CC(C)=CCC(CC)(CC)C1C(=O)C(C)C(OC)C(=O)C1C |
| InChI | InChI=1S/C24H42O3/c1-9-19(10-2)15-16(5)13-14-24(11-3,12-4)20-17(6)22(26)23(27-8)18(7)21(20)25/h13,17-20,23H,9-12,14-15H2,1-8H3 |
| InChIKey | NPVTZNAGTSHAHX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|