C17H22O2 — CID 135023117
4,6-dimethyl-7-prop-1-enyl-1-prop-2-enylspiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one (PubChem CID 135023117) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 4,6-dimethyl-7-prop-1-enyl-1-prop-2-enylspiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one.
| Compound Name | 4,6-dimethyl-7-prop-1-enyl-1-prop-2-enylspiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 135023117 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 4,6-dimethyl-7-prop-1-enyl-1-prop-2-enylspiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one |
| SMILES | C=CCC12C(=O)C3(CO3)C(C)(C=C1C)CC2C=CC |
| InChI | InChI=1S/C17H22O2/c1-5-7-13-10-15(4)9-12(3)16(13,8-6-2)14(18)17(15)11-19-17/h5-7,9,13H,2,8,10-11H2,1,3-4H3 |
| InChIKey | LLBKUPIGVKLDQB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|