C13H14O2 — CID 135022992
11'-methylspiro[oxirane-2,8'-tricyclo[5.2.2.01,5]undeca-3,10-diene]-9'-one (PubChem CID 135022992) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 11'-methylspiro[oxirane-2,8'-tricyclo[5.2.2.01,5]undeca-3,10-diene]-9'-one.
| Compound Name | 11'-methylspiro[oxirane-2,8'-tricyclo[5.2.2.01,5]undeca-3,10-diene]-9'-one |
|---|---|
| PubChem CID | 135022992 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 11'-methylspiro[oxirane-2,8'-tricyclo[5.2.2.01,5]undeca-3,10-diene]-9'-one |
| SMILES | CC1=CC23CC=CC2CC1C1(CO1)C3=O |
| InChI | InChI=1S/C13H14O2/c1-8-6-12-4-2-3-9(12)5-10(8)13(7-15-13)11(12)14/h2-3,6,9-10H,4-5,7H2,1H3 |
| InChIKey | MQIVGDOXLKUMKD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|