C14H16O2 — CID 10488913
(1'S,2R,2'R,6'S,7'R)-1',11'-dimethylspiro[oxirane-2,9'-tricyclo[5.2.2.02,6]undeca-4,10-diene]-8'-one (PubChem CID 10488913) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (1'S,2R,2'R,6'S,7'R)-1',11'-dimethylspiro[oxirane-2,9'-tricyclo[5.2.2.02,6]undeca-4,10-diene]-8'-one.
| Compound Name | (1'S,2R,2'R,6'S,7'R)-1',11'-dimethylspiro[oxirane-2,9'-tricyclo[5.2.2.02,6]undeca-4,10-diene]-8'-one |
|---|---|
| PubChem CID | 10488913 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (1'S,2R,2'R,6'S,7'R)-1',11'-dimethylspiro[oxirane-2,9'-tricyclo[5.2.2.02,6]undeca-4,10-diene]-8'-one |
| SMILES | CC1=C[C@]2(C)[C@@H]3CC=C[C@@H]3[C@H]1C(=O)[C@]21CO1 |
| InChI | InChI=1S/C14H16O2/c1-8-6-13(2)10-5-3-4-9(10)11(8)12(15)14(13)7-16-14/h3-4,6,9-11H,5,7H2,1-2H3/t9-,10+,11-,13+,14+/m0/s1 |
| InChIKey | HDKSJWCFULWTLU-FUVSOYRFSA-N |
| XLogP | 2.11 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|