C21H32O3 — CID 134980372
(1R,3S,5R,8E,12R,13R,16R)-3,5,9,12,13-pentamethyl-2-oxo-4-oxatricyclo[10.3.1.03,5]hexadec-8-ene-16-carbaldehyde (PubChem CID 134980372) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (1R,3S,5R,8E,12R,13R,16R)-3,5,9,12,13-pentamethyl-2-oxo-4-oxatricyclo[10.3.1.03,5]hexadec-8-ene-16-carbaldehyde.
| Compound Name | (1R,3S,5R,8E,12R,13R,16R)-3,5,9,12,13-pentamethyl-2-oxo-4-oxatricyclo[10.3.1.03,5]hexadec-8-ene-16-carbaldehyde |
|---|---|
| PubChem CID | 134980372 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (1R,3S,5R,8E,12R,13R,16R)-3,5,9,12,13-pentamethyl-2-oxo-4-oxatricyclo[10.3.1.03,5]hexadec-8-ene-16-carbaldehyde |
| SMILES | C/C1=C\CC[C@@]2(C)O[C@]2(C)C(=O)[C@@H]2CC[C@@H](C)[C@@](C)(CC1)[C@@H]2C=O |
| InChI | InChI=1S/C21H32O3/c1-14-7-6-11-20(4)21(5,24-20)18(23)16-9-8-15(2)19(3,12-10-14)17(16)13-22/h7,13,15-17H,6,8-12H2,1-5H3/b14-7+/t15-,16-,17-,19-,20-,21-/m1/s1 |
| InChIKey | JDOJEIBYQSKJCN-NIOJRVOVSA-N |
| XLogP | 4.49 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|