C28H48O3 — CID 159528148
(5S)-2,6,6-trimethyl-5-pentan-3-ylcyclohex-2-en-1-one;(1S,4S,6S)-1,3,3-trimethyl-4-pentan-3-yl-7-oxabicyclo[4.1.0]heptan-2-one (PubChem CID 159528148) has the molecular formula C28H48O3 and a molecular weight of 432.69 g/mol. Its IUPAC name is (5S)-2,6,6-trimethyl-5-pentan-3-ylcyclohex-2-en-1-one;(1S,4S,6S)-1,3,3-trimethyl-4-pentan-3-yl-7-oxabicyclo[4.1.0]heptan-2-one.
| Compound Name | (5S)-2,6,6-trimethyl-5-pentan-3-ylcyclohex-2-en-1-one;(1S,4S,6S)-1,3,3-trimethyl-4-pentan-3-yl-7-oxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 159528148 |
| Molecular Formula | C28H48O3 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | (5S)-2,6,6-trimethyl-5-pentan-3-ylcyclohex-2-en-1-one;(1S,4S,6S)-1,3,3-trimethyl-4-pentan-3-yl-7-oxabicyclo[4.1.0]heptan-2-one |
| SMILES | CCC(CC)[C@@H]1CC=C(C)C(=O)C1(C)C.CCC(CC)[C@@H]1C[C@@H]2O[C@]2(C)C(=O)C1(C)C |
| InChI | InChI=1S/C14H24O2.C14H24O/c1-6-9(7-2)10-8-11-14(5,16-11)12(15)13(10,3)4;1-6-11(7-2)12-9-8-10(3)13(15)14(12,4)5/h9-11H,6-8H2,1-5H3;8,11-12H,6-7,9H2,1-5H3/t10-,11-,14-;12-/m00/s1 |
| InChIKey | MCQIOUHICJRAEA-CSFGCLOISA-N |
| XLogP | 7.18 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|