C21H32O4 — CID 57134428
5-hydroxy-3-(3-methylbutanoyl)-2,2-bis(3-methylbut-2-enyl)cyclohexane-1,4-dione (PubChem CID 57134428) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 5-hydroxy-3-(3-methylbutanoyl)-2,2-bis(3-methylbut-2-enyl)cyclohexane-1,4-dione.
| Compound Name | 5-hydroxy-3-(3-methylbutanoyl)-2,2-bis(3-methylbut-2-enyl)cyclohexane-1,4-dione |
|---|---|
| PubChem CID | 57134428 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 5-hydroxy-3-(3-methylbutanoyl)-2,2-bis(3-methylbut-2-enyl)cyclohexane-1,4-dione |
| SMILES | CC(C)=CCC1(CC=C(C)C)C(=O)CC(O)C(=O)C1C(=O)CC(C)C |
| InChI | InChI=1S/C21H32O4/c1-13(2)7-9-21(10-8-14(3)4)18(24)12-17(23)20(25)19(21)16(22)11-15(5)6/h7-8,15,17,19,23H,9-12H2,1-6H3 |
| InChIKey | QMQBDZUVODYTCA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|