C24H42O3 — CID 91366581
6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-3-(2-methyloctan-2-yl)cyclohex-2-en-1-one (PubChem CID 91366581) has the molecular formula C24H42O3 and a molecular weight of 378.60 g/mol. Its IUPAC name is 6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-3-(2-methyloctan-2-yl)cyclohex-2-en-1-one.
| Compound Name | 6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-3-(2-methyloctan-2-yl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 91366581 |
| Molecular Formula | C24H42O3 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-3-(2-methyloctan-2-yl)cyclohex-2-en-1-one |
| SMILES | CCCCCCC(C)(C)C1=CC(=O)C(C2CC(O)CCC2CCCO)CC1 |
| InChI | InChI=1S/C24H42O3/c1-4-5-6-7-14-24(2,3)19-11-13-21(23(27)16-19)22-17-20(26)12-10-18(22)9-8-15-25/h16,18,20-22,25-26H,4-15,17H2,1-3H3 |
| InChIKey | RKNUXCOLNVVEBB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|