C24H40O3 — CID 87183316
3-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-2-(2-methyloctan-2-yl)phenol (PubChem CID 87183316) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is 3-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-2-(2-methyloctan-2-yl)phenol.
| Compound Name | 3-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-2-(2-methyloctan-2-yl)phenol |
|---|---|
| PubChem CID | 87183316 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | 3-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-2-(2-methyloctan-2-yl)phenol |
| SMILES | CCCCCCC(C)(C)c1c(O)cccc1C1CC(O)CCC1CCCO |
| InChI | InChI=1S/C24H40O3/c1-4-5-6-7-15-24(2,3)23-20(11-8-12-22(23)27)21-17-19(26)14-13-18(21)10-9-16-25/h8,11-12,18-19,21,25-27H,4-7,9-10,13-17H2,1-3H3 |
| InChIKey | JVVYRFPSWBEKGC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|