C30H50O4 — CID 123576441
5-[(2E)-10-ethyl-3,5,5,8,10,13-hexamethyltetradeca-2,7,12-trienyl]-4-hydroxy-3-methoxy-6-methylcyclohexane-1,2-dione (PubChem CID 123576441) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is 5-[(2E)-10-ethyl-3,5,5,8,10,13-hexamethyltetradeca-2,7,12-trienyl]-4-hydroxy-3-methoxy-6-methylcyclohexane-1,2-dione.
| Compound Name | 5-[(2E)-10-ethyl-3,5,5,8,10,13-hexamethyltetradeca-2,7,12-trienyl]-4-hydroxy-3-methoxy-6-methylcyclohexane-1,2-dione |
|---|---|
| PubChem CID | 123576441 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | 5-[(2E)-10-ethyl-3,5,5,8,10,13-hexamethyltetradeca-2,7,12-trienyl]-4-hydroxy-3-methoxy-6-methylcyclohexane-1,2-dione |
| SMILES | CCC(C)(CC=C(C)C)CC(C)=CCC(C)(C)C/C(C)=C/CC1C(C)C(=O)C(=O)C(OC)C1O |
| InChI | InChI=1S/C30H50O4/c1-11-30(9,17-14-20(2)3)19-22(5)15-16-29(7,8)18-21(4)12-13-24-23(6)25(31)27(33)28(34-10)26(24)32/h12,14-15,23-24,26,28,32H,11,13,16-19H2,1-10H3/b21-12+,22-15? |
| InChIKey | KTXZRJUQFIACNE-RTPRPIFESA-N |
| XLogP | 7.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|