C23H36O4 — CID 123226197
4-hydroxy-3-methoxy-5-methyl-6-(3,7,11-trimethyldodeca-2,6,10-trienyl)cyclohexane-1,2-dione (PubChem CID 123226197) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is 4-hydroxy-3-methoxy-5-methyl-6-(3,7,11-trimethyldodeca-2,6,10-trienyl)cyclohexane-1,2-dione.
| Compound Name | 4-hydroxy-3-methoxy-5-methyl-6-(3,7,11-trimethyldodeca-2,6,10-trienyl)cyclohexane-1,2-dione |
|---|---|
| PubChem CID | 123226197 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 4-hydroxy-3-methoxy-5-methyl-6-(3,7,11-trimethyldodeca-2,6,10-trienyl)cyclohexane-1,2-dione |
| SMILES | COC1C(=O)C(=O)C(CC=C(C)CCC=C(C)CCC=C(C)C)C(C)C1O |
| InChI | InChI=1S/C23H36O4/c1-15(2)9-7-10-16(3)11-8-12-17(4)13-14-19-18(5)20(24)23(27-6)22(26)21(19)25/h9,11,13,18-20,23-24H,7-8,10,12,14H2,1-6H3 |
| InChIKey | DCKSXAQBNSIQBV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|