C26H40O4 — CID 123545761
5-hydroxy-3-[2-[1-(6-hydroxy-6-methylheptan-2-yl)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethyl]cyclohexane-1,2-dione (PubChem CID 123545761) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is 5-hydroxy-3-[2-[1-(6-hydroxy-6-methylheptan-2-yl)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethyl]cyclohexane-1,2-dione.
| Compound Name | 5-hydroxy-3-[2-[1-(6-hydroxy-6-methylheptan-2-yl)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethyl]cyclohexane-1,2-dione |
|---|---|
| PubChem CID | 123545761 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 5-hydroxy-3-[2-[1-(6-hydroxy-6-methylheptan-2-yl)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethyl]cyclohexane-1,2-dione |
| SMILES | CC(CCCC(C)(C)O)C1=CCC2C(=CCC3CC(O)CC(=O)C3=O)CCCC12C |
| InChI | InChI=1S/C26H40O4/c1-17(7-5-13-25(2,3)30)21-11-12-22-18(8-6-14-26(21,22)4)9-10-19-15-20(27)16-23(28)24(19)29/h9,11,17,19-20,22,27,30H,5-8,10,12-16H2,1-4H3 |
| InChIKey | BXNNCTYYVJKTAQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|