C17H26O6 — CID 100931423
triethyl (1R,2S,5S)-5-propylcyclopent-3-ene-1,2,3-tricarboxylate (PubChem CID 100931423) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is triethyl (1R,2S,5S)-5-propylcyclopent-3-ene-1,2,3-tricarboxylate.
| Compound Name | triethyl (1R,2S,5S)-5-propylcyclopent-3-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 100931423 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | triethyl (1R,2S,5S)-5-propylcyclopent-3-ene-1,2,3-tricarboxylate |
| SMILES | CCC[C@H]1C=C(C(=O)OCC)[C@@H](C(=O)OCC)[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C17H26O6/c1-5-9-11-10-12(15(18)21-6-2)14(17(20)23-8-4)13(11)16(19)22-7-3/h10-11,13-14H,5-9H2,1-4H3/t11-,13+,14+/m0/s1 |
| InChIKey | HGDGQRKAXQTWPL-IACUBPJLSA-N |
| XLogP | 2.26 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|