C15H19ClO — CID 100931970
1-chloro-3-[(1R,6R)-3,4,6-trimethylcyclohex-3-en-1-yl]oxybenzene (PubChem CID 100931970) has the molecular formula C15H19ClO and a molecular weight of 250.77 g/mol. Its IUPAC name is 1-chloro-3-[(1R,6R)-3,4,6-trimethylcyclohex-3-en-1-yl]oxybenzene.
| Compound Name | 1-chloro-3-[(1R,6R)-3,4,6-trimethylcyclohex-3-en-1-yl]oxybenzene |
|---|---|
| PubChem CID | 100931970 |
| Molecular Formula | C15H19ClO |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-chloro-3-[(1R,6R)-3,4,6-trimethylcyclohex-3-en-1-yl]oxybenzene |
| SMILES | CC1=C(C)C[C@@H](Oc2cccc(Cl)c2)[C@H](C)C1 |
| InChI | InChI=1S/C15H19ClO/c1-10-7-12(3)15(8-11(10)2)17-14-6-4-5-13(16)9-14/h4-6,9,12,15H,7-8H2,1-3H3/t12-,15-/m1/s1 |
| InChIKey | SOUQDVTVINZZAL-IUODEOHRSA-N |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|