About cyclohexene-1-sulfinyl chloride
cyclohexene-1-sulfinyl chloride (PubChem CID 100934688) has the molecular formula C6H9ClOS
and a molecular weight of 164.66 g/mol. Its IUPAC name is cyclohexene-1-sulfinyl chloride.
Molecular Properties
| Compound Name | cyclohexene-1-sulfinyl chloride |
| PubChem CID | 100934688 |
| Molecular Formula | C6H9ClOS |
| Molecular Weight | 164.66 g/mol |
| Exact Mass | 164.01 |
| IUPAC Name | cyclohexene-1-sulfinyl chloride |
| SMILES | O=S(Cl)C1=CCCCC1 |
| InChI | InChI=1S/C6H9ClOS/c7-9(8)6-4-2-1-3-5-6/h4H,1-3,5H2 |
| InChIKey | NZHVAZJSYYQILM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.66 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohexene-1-sulfinyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexene-1-sulfinyl chloride?
The IUPAC name of cyclohexene-1-sulfinyl chloride (CID 100934688) is cyclohexene-1-sulfinyl chloride.
What is the SMILES notation for cyclohexene-1-sulfinyl chloride?
The canonical SMILES for cyclohexene-1-sulfinyl chloride is O=S(Cl)C1=CCCCC1.
What is the InChIKey of cyclohexene-1-sulfinyl chloride?
The InChIKey is NZHVAZJSYYQILM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClOS/c7-9(8)6-4-2-1-3-5-6/h4H,1-3,5H2.
What are the key properties of cyclohexene-1-sulfinyl chloride?
cyclohexene-1-sulfinyl chloride has a molecular weight of 164.66 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexene-1-sulfinyl chloride is sourced from PubChem (CID 100934688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).