C24H29N5O2 — CID 10093546
2-[(3R,5R)-3-azido-8-methyl-5-(4-methylphenyl)-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]-N-tert-butylacetamide (PubChem CID 10093546) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-[(3R,5R)-3-azido-8-methyl-5-(4-methylphenyl)-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]-N-tert-butylacetamide.
| Compound Name | 2-[(3R,5R)-3-azido-8-methyl-5-(4-methylphenyl)-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 10093546 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 2-[(3R,5R)-3-azido-8-methyl-5-(4-methylphenyl)-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]-N-tert-butylacetamide |
| SMILES | Cc1ccc([C@H]2C[C@@H](N=[N+]=[N-])C(=O)N(CC(=O)NC(C)(C)C)c3cc(C)ccc32)cc1 |
| InChI | InChI=1S/C24H29N5O2/c1-15-6-9-17(10-7-15)19-13-20(27-28-25)23(31)29(14-22(30)26-24(3,4)5)21-12-16(2)8-11-18(19)21/h6-12,19-20H,13-14H2,1-5H3,(H,26,30)/t19-,20-/m1/s1 |
| InChIKey | LBHLEGQXZYGEIO-WOJBJXKFSA-N |
| XLogP | 4.77 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|