C24H35N5O2 — CID 54572718
2-[3-azido-5-(cyclohexylmethyl)-8-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]-N-tert-butylacetamide (PubChem CID 54572718) has the molecular formula C24H35N5O2 and a molecular weight of 425.58 g/mol. Its IUPAC name is 2-[3-azido-5-(cyclohexylmethyl)-8-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]-N-tert-butylacetamide.
| Compound Name | 2-[3-azido-5-(cyclohexylmethyl)-8-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 54572718 |
| Molecular Formula | C24H35N5O2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | 2-[3-azido-5-(cyclohexylmethyl)-8-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]-N-tert-butylacetamide |
| SMILES | Cc1ccc2c(c1)N(CC(=O)NC(C)(C)C)C(=O)C(N=[N+]=[N-])CC2CC1CCCCC1 |
| InChI | InChI=1S/C24H35N5O2/c1-16-10-11-19-18(13-17-8-6-5-7-9-17)14-20(27-28-25)23(31)29(21(19)12-16)15-22(30)26-24(2,3)4/h10-12,17-18,20H,5-9,13-15H2,1-4H3,(H,26,30) |
| InChIKey | ZYLIDDCTZUOXKN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|