C25H31N5O3 — CID 57223338
2-[3-azido-5-(2-methoxyphenyl)-2-oxo-7-phenylazepan-1-yl]-N-tert-butylacetamide (PubChem CID 57223338) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is 2-[3-azido-5-(2-methoxyphenyl)-2-oxo-7-phenylazepan-1-yl]-N-tert-butylacetamide.
| Compound Name | 2-[3-azido-5-(2-methoxyphenyl)-2-oxo-7-phenylazepan-1-yl]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 57223338 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 2-[3-azido-5-(2-methoxyphenyl)-2-oxo-7-phenylazepan-1-yl]-N-tert-butylacetamide |
| SMILES | COc1ccccc1C1CC(N=[N+]=[N-])C(=O)N(CC(=O)NC(C)(C)C)C(c2ccccc2)C1 |
| InChI | InChI=1S/C25H31N5O3/c1-25(2,3)27-23(31)16-30-21(17-10-6-5-7-11-17)15-18(14-20(24(30)32)28-29-26)19-12-8-9-13-22(19)33-4/h5-13,18,20-21H,14-16H2,1-4H3,(H,27,31) |
| InChIKey | NVFIFBIGTKBDDZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|