C25H31BrN2O3 — CID 54202250
2-[3-bromo-5-(2-methoxyphenyl)-2-oxo-7-phenylazepan-1-yl]-N-tert-butylacetamide (PubChem CID 54202250) has the molecular formula C25H31BrN2O3 and a molecular weight of 487.44 g/mol. Its IUPAC name is 2-[3-bromo-5-(2-methoxyphenyl)-2-oxo-7-phenylazepan-1-yl]-N-tert-butylacetamide.
| Compound Name | 2-[3-bromo-5-(2-methoxyphenyl)-2-oxo-7-phenylazepan-1-yl]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 54202250 |
| Molecular Formula | C25H31BrN2O3 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 2-[3-bromo-5-(2-methoxyphenyl)-2-oxo-7-phenylazepan-1-yl]-N-tert-butylacetamide |
| SMILES | COc1ccccc1C1CC(Br)C(=O)N(CC(=O)NC(C)(C)C)C(c2ccccc2)C1 |
| InChI | InChI=1S/C25H31BrN2O3/c1-25(2,3)27-23(29)16-28-21(17-10-6-5-7-11-17)15-18(14-20(26)24(28)30)19-12-8-9-13-22(19)31-4/h5-13,18,20-21H,14-16H2,1-4H3,(H,27,29) |
| InChIKey | PQBNTVNOPMYFLC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|