C24H29N5O2 — CID 54378637
N-(3-azido-2-oxo-5,7-diphenylazepan-1-yl)-3,3-dimethylbutanamide (PubChem CID 54378637) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-(3-azido-2-oxo-5,7-diphenylazepan-1-yl)-3,3-dimethylbutanamide.
| Compound Name | N-(3-azido-2-oxo-5,7-diphenylazepan-1-yl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 54378637 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-(3-azido-2-oxo-5,7-diphenylazepan-1-yl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NN1C(=O)C(N=[N+]=[N-])CC(c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C24H29N5O2/c1-24(2,3)16-22(30)27-29-21(18-12-8-5-9-13-18)15-19(17-10-6-4-7-11-17)14-20(23(29)31)26-28-25/h4-13,19-21H,14-16H2,1-3H3,(H,27,30) |
| InChIKey | UYIVKGWYUPVVGM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|