C26H31CsN2O8 — CID 100936279
cesium 4-[5-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-3,4-dihydropyrazol-2-yl]benzoate (PubChem CID 100936279) has the molecular formula C26H31CsN2O8 and a molecular weight of 632.44 g/mol. Its IUPAC name is cesium 4-[5-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-3,4-dihydropyrazol-2-yl]benzoate.
| Compound Name | cesium 4-[5-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-3,4-dihydropyrazol-2-yl]benzoate |
|---|---|
| PubChem CID | 100936279 |
| Molecular Formula | C26H31CsN2O8 |
| Molecular Weight | 632.44 g/mol |
| Exact Mass | 632.11 |
| IUPAC Name | cesium 4-[5-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-3,4-dihydropyrazol-2-yl]benzoate |
| SMILES | O=C([O-])c1ccc(N2CCC(c3ccc4c(c3)OCCOCCOCCOCCOCCO4)=N2)cc1.[Cs+] |
| InChI | InChI=1S/C26H32N2O8.Cs/c29-26(30)20-1-4-22(5-2-20)28-8-7-23(27-28)21-3-6-24-25(19-21)36-18-16-34-14-12-32-10-9-31-11-13-33-15-17-35-24;/h1-6,19H,7-18H2,(H,29,30);/q;+1/p-1 |
| InChIKey | CWAQKGGQYFOBCG-UHFFFAOYSA-M |
| XLogP | -1.49 |
| TPSA | 111.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.44 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |