C19H28N2O5S — CID 100936967
[(E)-but-2-enyl] 2-[[(2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoyl]amino]acetate (PubChem CID 100936967) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is [(E)-but-2-enyl] 2-[[(2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoyl]amino]acetate.
| Compound Name | [(E)-but-2-enyl] 2-[[(2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoyl]amino]acetate |
|---|---|
| PubChem CID | 100936967 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [(E)-but-2-enyl] 2-[[(2S)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoyl]amino]acetate |
| SMILES | C/C=C/COC(=O)CNC(=O)[C@H](CC(C)C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H28N2O5S/c1-5-6-11-26-18(22)13-20-19(23)17(12-14(2)3)21-27(24,25)16-9-7-15(4)8-10-16/h5-10,14,17,21H,11-13H2,1-4H3,(H,20,23)/b6-5+/t17-/m0/s1 |
| InChIKey | VZCXZEAYAFLHKZ-RTRPANQVSA-N |
| XLogP | 1.92 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|