C24H36O3Si3 — CID 100937357
benzyl [(2,4,6-trimethylbenzoyl)-bis(trimethylsilyl)silyl]formate (PubChem CID 100937357) has the molecular formula C24H36O3Si3 and a molecular weight of 456.81 g/mol. Its IUPAC name is benzyl [(2,4,6-trimethylbenzoyl)-bis(trimethylsilyl)silyl]formate.
| Compound Name | benzyl [(2,4,6-trimethylbenzoyl)-bis(trimethylsilyl)silyl]formate |
|---|---|
| PubChem CID | 100937357 |
| Molecular Formula | C24H36O3Si3 |
| Molecular Weight | 456.81 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | benzyl [(2,4,6-trimethylbenzoyl)-bis(trimethylsilyl)silyl]formate |
| SMILES | Cc1cc(C)c(C(=O)[Si](C(=O)OCc2ccccc2)([Si](C)(C)C)[Si](C)(C)C)c(C)c1 |
| InChI | InChI=1S/C24H36O3Si3/c1-18-15-19(2)22(20(3)16-18)23(25)30(28(4,5)6,29(7,8)9)24(26)27-17-21-13-11-10-12-14-21/h10-16H,17H2,1-9H3 |
| InChIKey | WJMYCBFUSOKVEM-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.81 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|