C27H24O12 — CID 100938150
[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(1,3,6,7-tetrahydroxy-9-oxo-10H-anthracen-2-yl)oxy]oxan-3-yl] benzoate (PubChem CID 100938150) has the molecular formula C27H24O12 and a molecular weight of 540.48 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(1,3,6,7-tetrahydroxy-9-oxo-10H-anthracen-2-yl)oxy]oxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(1,3,6,7-tetrahydroxy-9-oxo-10H-anthracen-2-yl)oxy]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 100938150 |
| Molecular Formula | C27H24O12 |
| Molecular Weight | 540.48 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(1,3,6,7-tetrahydroxy-9-oxo-10H-anthracen-2-yl)oxy]oxan-3-yl] benzoate |
| SMILES | O=C(O[C@H]1[C@H](Oc2c(O)cc3c(c2O)C(=O)c2cc(O)c(O)cc2C3)O[C@H](CO)[C@@H](O)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C27H24O12/c28-10-18-21(33)23(35)25(38-26(36)11-4-2-1-3-5-11)27(37-18)39-24-17(31)8-13-6-12-7-15(29)16(30)9-14(12)20(32)19(13)22(24)34/h1-5,7-9,18,21,23,25,27-31,33-35H,6,10H2/t18-,21-,23+,25-,27+/m1/s1 |
| InChIKey | MHLKHVGXIZYUDD-UPMJOKTLSA-N |
| XLogP | 0.69 |
| TPSA | 203.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.48 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|