C28H32N4 — CID 10093854
5-(3-methylbut-2-enyl)-2-phenyl-1H-imidazole (PubChem CID 10093854) has the molecular formula C28H32N4 and a molecular weight of 424.59 g/mol. Its IUPAC name is 5-(3-methylbut-2-enyl)-2-phenyl-1H-imidazole.
| Compound Name | 5-(3-methylbut-2-enyl)-2-phenyl-1H-imidazole |
|---|---|
| PubChem CID | 10093854 |
| Molecular Formula | C28H32N4 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 5-(3-methylbut-2-enyl)-2-phenyl-1H-imidazole |
| SMILES | CC(C)=CCc1cnc(-c2ccccc2)[nH]1.CC(C)=CCc1cnc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/2C14H16N2/c2*1-11(2)8-9-13-10-15-14(16-13)12-6-4-3-5-7-12/h2*3-8,10H,9H2,1-2H3,(H,15,16) |
| InChIKey | ULZLGKLOJPTXMU-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|