C25H44O2 — CID 100938716
6-methyl-2-[(E)-nonadec-10-enyl]-2,3-dihydropyran-4-one (PubChem CID 100938716) has the molecular formula C25H44O2 and a molecular weight of 376.63 g/mol. Its IUPAC name is 6-methyl-2-[(E)-nonadec-10-enyl]-2,3-dihydropyran-4-one.
| Compound Name | 6-methyl-2-[(E)-nonadec-10-enyl]-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 100938716 |
| Molecular Formula | C25H44O2 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | 6-methyl-2-[(E)-nonadec-10-enyl]-2,3-dihydropyran-4-one |
| SMILES | CCCCCCCC/C=C/CCCCCCCCCC1CC(=O)C=C(C)O1 |
| InChI | InChI=1S/C25H44O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-22-24(26)21-23(2)27-25/h10-11,21,25H,3-9,12-20,22H2,1-2H3/b11-10+ |
| InChIKey | BWJGPBYNCWFMBW-ZHACJKMWSA-N |
| XLogP | 8.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|