C12H17F3O2 — CID 10634406
2-hexyl-6-(trifluoromethyl)-2,3-dihydropyran-4-one (PubChem CID 10634406) has the molecular formula C12H17F3O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-hexyl-6-(trifluoromethyl)-2,3-dihydropyran-4-one.
| Compound Name | 2-hexyl-6-(trifluoromethyl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 10634406 |
| Molecular Formula | C12H17F3O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-hexyl-6-(trifluoromethyl)-2,3-dihydropyran-4-one |
| SMILES | CCCCCCC1CC(=O)C=C(C(F)(F)F)O1 |
| InChI | InChI=1S/C12H17F3O2/c1-2-3-4-5-6-10-7-9(16)8-11(17-10)12(13,14)15/h8,10H,2-7H2,1H3 |
| InChIKey | WEVAFXUICDICHK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|