C14H20F2O2 — CID 102411975
2-cyclohexyl-3,3-difluoro-6-propyl-2H-pyran-4-one (PubChem CID 102411975) has the molecular formula C14H20F2O2 and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-cyclohexyl-3,3-difluoro-6-propyl-2H-pyran-4-one.
| Compound Name | 2-cyclohexyl-3,3-difluoro-6-propyl-2H-pyran-4-one |
|---|---|
| PubChem CID | 102411975 |
| Molecular Formula | C14H20F2O2 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-cyclohexyl-3,3-difluoro-6-propyl-2H-pyran-4-one |
| SMILES | CCCC1=CC(=O)C(F)(F)C(C2CCCCC2)O1 |
| InChI | InChI=1S/C14H20F2O2/c1-2-6-11-9-12(17)14(15,16)13(18-11)10-7-4-3-5-8-10/h9-10,13H,2-8H2,1H3 |
| InChIKey | KLCIAXCBRUUUCE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |